{"product_id":"abcam-ab141259","title":"Abcam, ab141259, NNGH, Matrix metalloprotease (MMP) inhibitor","description":"\u003cp\u003eSize: 5mg \/ 25mg\u003cbr\u003e\nMW 316.38 Da, Purity \u0026gt;98%. MMP3 (Stromelysin-1) inhibitor. Additionally shows broad spectrum inhibition activity at other MMPs. Cell permeable.\u003cbr\u003e\nKey facts\u003cbr\u003e\nCAS number:161314-17-6,\u003cbr\u003e\nPurity:\u0026gt;98%,\u003cbr\u003e\nForm:SolidSee storage information,\u003cbr\u003e\nMolecular weight:316.38 Da,\u003cbr\u003e\nMolecular formula:C13H20N2O5S,\u003cbr\u003e\nPubChem:448002,\u003cbr\u003e\nNature:Synthetic,\u003cbr\u003e\nSolubility:Soluble in DMSO to 100 mMSoluble in ethanol to 25 mM,\u003cbr\u003e\nBiochemical name:N-Isobutyl-N-[4-methoxyphenylsulfonyl]glycyl hydroxamic acid,\u003cbr\u003e\nBiological description:MMP3 (Stromelysin-1) inhibitor. Additionally shows broad spectrum inhibition activity at other MMPs. Cell permeable.,\u003cbr\u003e\nCanonical smiles:CC(C)CN(CC(=O)NO)S(=O)(=O)C1=CC=C(C=C1)OC,\u003cbr\u003e\nInChi:InChI=1S\/C13H20N2O5S\/c1-10(2)8-15(9-13(16)14-17)21(18,19)12-6-4-11(20-3)5-7-12\/h4-7,10,17H,8-9H2,1-3H3,(H,14,16),\u003cbr\u003e\nInChiKey:JIRXORZYIXSWOB-UHFFFAOYSA-N,\u003cbr\u003e\nIUPAC Name:N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]acetamide\u003c\/p\u003e\n\n\u003cp\u003eProperties and Storage Information:\u003cbr\u003e\nShipped at conditions-Ambient - Can Ship with Ice, Appropriate short-term storage conditions-Ambient, Appropriate long-term storage conditions-Ambient, Storage information-The product can be stored for up to 12 months\u003c\/p\u003e\n\n\u003cp\u003eSupplementary Information:\u003cbr\u003e\nThis supplementary information is collated from multiple sources and compiled automatically.\u003cbr\u003e\nMatrix metalloproteases (MMPs) are a group of zinc-dependent enzymes known for their ability to degrade extracellular matrix components. Notable members of this family include MMP14 MMP1 MMP2 MMP3 MMP9 MMP13 MMP7 MMP8 and MMP12 as well as the ADAM17 which serves similar functions. Some of these proteases such as MMP1 and MMP9 are widely expressed in various tissues such as connective epithelial and endothelial tissues. Each of these proteases has a specific molecular weight; for instance MMP9 has an approximate molecular weight of 92 kDa. MMP inhibitors regulate these enzymes preventing excessive degradation of the extracellular matrix which helps maintain tissue structure.\u003cbr\u003e\nBiological function summary\u003cbr\u003e\nMatrix metalloproteases play a role in tissue remodeling wound healing and the inflammatory response. These enzymes collaborate in complexes that manage extracellular matrix degradation ensuring proper tissue repair and remodeling. MMP7 also called matrilysin has a role in processing bioactive molecules. ADAM17 known as TACE (Tumor Necrosis Factor-Alpha-Converting Enzyme) regulates the shedding of cell surface proteins that affect cell signaling and communication. Inhibiting specific MMPs helps control excessive matrix degradation representing an important function in maintaining cellular environments.\u003cbr\u003e\nPathways\u003cbr\u003e\nThe functions of matrix metalloproteases extend into processes like the cytokine signaling pathway and the cell-matrix adhesion pathway. MMP9 and other MMPs facilitate the release of cytokines growth factors and cell surface receptors which are central to immune responses and cell migration. Links between these proteases and proteins such as tissue inhibitors of metalloproteinases (TIMPs) balance matrix degradation and synthesis. This regulation is critical for maintaining homeostasis and proper tissue architecture.\u003cbr\u003e\nChronic overexpression or dysregulation of matrix metalloproteases associates with conditions like osteoarthritis and cancer. MMP13 and MMP9 show increased activity in osteoarthritic tissue contributing to cartilage degradation. In cancer MMPs promote tumor progression and metastasis through extracellular matrix restructuring. ADAM17 involves in cancer as its role in cytokine shedding impacts cancer cell communication and proliferation. Targeting specific MMPs with inhibitors provides potential therapeutic strategies for these diseases aiming to halt pathological tissue breakdown and tumor progression.\u003c\/p\u003e","brand":"Abcam","offers":[{"title":"Default Title","offer_id":46847449301161,"sku":"ab141259","price":0.99,"currency_code":"USD","in_stock":true}],"url":"https:\/\/iright.com\/es\/products\/abcam-ab141259","provider":"Iright","version":"1.0","type":"link"}