{"product_id":"abcam-ab141553","title":"Abcam, ab141553, Ibuprofen, NSAID","description":"\u003cp\u003eSize: 5g\u003cbr\u003e\nMW 206.28 Da, Purity \u0026gt;99%. A nonsteroidal anti-inflammatory drug (NSAID). Non-selective inhibitor of COX-1 and COX-2 (IC 50  values are 12 and 80 μM respectively). Inhibits thromboxane B2 release (IC 50  = 1.27 μM) and anandamide metabolism (IC 50  = 400 μM).\u003cbr\u003e\nKey facts\u003cbr\u003e\nCAS number:15687-27-1,\u003cbr\u003e\nPurity:\u0026gt;99%,\u003cbr\u003e\nForm:SolidSee storage information,\u003cbr\u003e\nMolecular weight:206.28 Da,\u003cbr\u003e\nMolecular formula:C13H18O2,\u003cbr\u003e\nPubChem:3672,\u003cbr\u003e\nNature:Synthetic,\u003cbr\u003e\nSolubility:Soluble in ethanol to 100 mM,\u003cbr\u003e\nBiochemical name:Ibuprofen,\u003cbr\u003e\nBiological description:A nonsteroidal anti-inflammatory drug (NSAID). Non-selective inhibitor of COX-1 and COX-2 (IC50 values are 12 and 80 μM respectively). Inhibits thromboxane B2 release (IC50 = 1.27 μM) and anandamide metabolism (IC50 = 400 μM).,\u003cbr\u003e\nCanonical smiles:CC(C)CC1=CC=C(C=C1)C(C)C(=O)O,\u003cbr\u003e\nInChi:InChI=1S\/C13H18O2\/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15\/h4-7,9-10H,8H2,1-3H3,(H,14,15),\u003cbr\u003e\nInChiKey:HEFNNWSXXWATRW-UHFFFAOYSA-N,\u003cbr\u003e\nIUPAC Name:2-[4-(2-methylpropyl)phenyl]propanoic acid\u003c\/p\u003e\n\n\u003cp\u003eProperties and Storage Information:\u003cbr\u003e\nShipped at conditions-Ambient - Can Ship with Ice, Appropriate short-term storage conditions-Ambient, Appropriate long-term storage conditions-Ambient, Storage information-The product can be stored for up to 12 months\u003c\/p\u003e\n\n\u003cp\u003eSupplementary Information:\u003cbr\u003e\nThis supplementary information is collated from multiple sources and compiled automatically.\u003cbr\u003e\nCyclooxygenase 2 (COX2) and Cyclooxygenase 1 (COX1) also known as Prostaglandin-endoperoxide synthase 2 and 1 respectively are enzymes involved in the conversion of arachidonic acid to prostaglandins and thromboxane playing key roles in inflammation and hemostasis. COX2 has a molecular weight of about 72 kDa while COX1 weighs approximately 70 kDa. COX1 is mostly expressed in the stomach platelets and kidneys maintaining gastric mucosa integrity and platelet aggregation whereas COX2 is inducible and found in response to inflammatory stimuli in sites such as the brain kidney and synovial tissues. Rat albumin acts as a transport protein carrying hormones vitamins and drugs and is a major component of blood plasma with a molecular weight of roughly 67 kDa.\u003cbr\u003e\nBiological function summary\u003cbr\u003e\nCOX enzymes catalyze the formation of prostaglandins which are lipid compounds having diverse hormone-like effects in different tissues. COX1 generates prostaglandins that protect the stomach lining and regulate blood platelets whereas COX2 produces prostaglandins that mediate inflammation and pain. While COX1 is usually expressed as a homodimer COX2 often forms more complex interactions due to its regulated expression during inflammation. Rat albumin apart from its role in transport helps maintain oncotic pressure and serves as a reservoir of proteins for tissue metabolism and repair.\u003cbr\u003e\nPathways\u003cbr\u003e\nCOX1 and COX2 are integral parts of the prostaglandin biosynthesis pathway and the broader arachidonic acid metabolism pathway. COX2 is especially critical in the inflammatory response pathways often interacting with signaling proteins like nuclear factor kappa-light-chain-enhancer of activated B cells (NF-κB). COX1 interacts with similar pathways but usually in relation to homeostatic maintenance. Both enzymes can indirectly influence other cytokine signaling pathways thereby interconnecting with multiple regulatory proteins like lipoxygenase which also acts on arachidonic acid substrates.\u003cbr\u003e\nCOX2 is linked to chronic inflammatory conditions such as arthritis and certain cancers due to its role in promoting inflammation and cell proliferation. Nonsteroidal anti-inflammatory drugs (NSAIDs) such as ibuprofen specifically target COX enzymes to reduce inflammation and alleviate pain. COX1 while less associated with disease states than COX2 can contribute to gastric ulcers when inhibited as its protective gastrointestinal prostaglandins are reduced. The dysregulation of these enzymes intertwines COX2 with oncogenic proteins like cyclin D1 in tumorigenesis whereas COX1 increasingly connects with thrombotic disorders.\u003c\/p\u003e","brand":"Abcam","offers":[{"title":"Default Title","offer_id":46847456018601,"sku":"ab141553","price":0.99,"currency_code":"USD","in_stock":true}],"url":"https:\/\/iright.com\/es\/products\/abcam-ab141553","provider":"Iright","version":"1.0","type":"link"}